CAS 1218790-41-0
:2-(Diethoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
2-(Diethoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its complex structure, which includes a pyridine ring and a boron-containing moiety. The presence of the diethoxymethyl group suggests that it has potential applications in organic synthesis, particularly in the formation of carbon-boron bonds, which are valuable in various chemical reactions, including cross-coupling reactions. The tetramethyl-1,3,2-dioxaborolane structure contributes to its stability and reactivity, making it a useful intermediate in the synthesis of more complex molecules. This compound may exhibit properties such as solubility in organic solvents and potential reactivity with nucleophiles due to the electrophilic nature of the boron atom. Additionally, its unique functional groups may impart specific biological or chemical properties, making it of interest in medicinal chemistry or materials science. Overall, this compound represents a versatile building block in synthetic organic chemistry, with potential applications in various fields.
Formula:C16H26BNO4
InChI:InChI=1S/C16H26BNO4/c1-7-19-14(20-8-2)13-12(10-9-11-18-13)17-21-15(3,4)16(5,6)22-17/h9-11,14H,7-8H2,1-6H3
InChI key:InChIKey=OILOYJRCMVEUOC-UHFFFAOYSA-N
SMILES:C(OCC)(OCC)C1=C(B2OC(C)(C)C(C)(C)O2)C=CC=N1
Synonyms:- Pyridine, 2-(diethoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 2-(Diethoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Diethoxymethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C16H26BNO4Molecular weight:307.1929
