CymitQuimica logo

CAS 1218790-47-6

:

2-Methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylene]-2-propanamine

Description:
2-Methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylene]-2-propanamine is a chemical compound characterized by its complex structure, which includes a propanamine backbone and a boron-containing moiety. The presence of the tetramethyl-1,3,2-dioxaborolane group suggests potential applications in organic synthesis and medicinal chemistry, particularly in the development of boron-based reagents or catalysts. The compound's molecular structure indicates it may exhibit unique reactivity due to the boron atom, which can participate in various chemical transformations. Additionally, the presence of the methyl and phenyl groups may influence its solubility, stability, and interaction with biological systems. As with many amines, it may also exhibit basic properties, allowing it to form salts with acids. Overall, this compound's characteristics make it a subject of interest in research areas such as drug development, materials science, and catalysis. However, specific physical and chemical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C17H26BNO2
InChI:InChI=1S/C17H26BNO2/c1-15(2,3)19-12-13-8-10-14(11-9-13)18-20-16(4,5)17(6,7)21-18/h8-12H,1-7H3
InChI key:InChIKey=AEUHECHOAUPUBY-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC=C(C=NC(C)(C)C)C=C2
Synonyms:
  • 2-Propanamine, 2-methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylene]-
  • 2-Methyl-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methylene]-2-propanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.