CAS 1218790-71-6: B-(4-Formyl-3,5-dimethylphenyl)boronic acid
Description:B-(4-Formyl-3,5-dimethylphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that features a formyl group and two methyl substituents. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The presence of the formyl group suggests potential reactivity in condensation reactions, while the methyl groups can influence the compound's steric and electronic properties. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are vital in the formation of carbon-carbon bonds in organic chemistry. The compound's solubility and stability can vary depending on the solvent and conditions, and it may exhibit distinct spectral characteristics in techniques such as NMR and IR spectroscopy. Overall, B-(4-Formyl-3,5-dimethylphenyl)boronic acid is a versatile building block in synthetic organic chemistry.
Formula:C9H11BO3
InChI:InChI=1S/C9H11BO3/c1-6-3-8(10(12)13)4-7(2)9(6)5-11/h3-5,12-13H,1-2H3
InChI key:InChIKey=HMOKNSHYDFAZAZ-UHFFFAOYSA-N
SMILES:O=CC=1C(=CC(=CC1C)B(O)O)C
- Synonyms:
- B-(4-Formyl-3,5-dimethylphenyl)boronic acid
- (4-Formyl-3,5-dimethylphenyl)boronic acid
- Boronic acid, B-(4-formyl-3,5-dimethylphenyl)-
- 3,5-Dimethyl-4-formylphenylboronic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Boronic acid, B-(4-formyl-3,5-dimethylphenyl)- REF: IN-DA001699CAS: 1218790-71-6 | 97% | To inquire | Tue 15 Apr 25 |
 | 4-Formyl-3,5-dimethylphenylboronic acid REF: 54-OR360207CAS: 1218790-71-6 | - - - | To inquire | Wed 16 Apr 25 |
 | (4-Formyl-3,5-dimethylphenyl)boronic acid REF: 10-F694088CAS: 1218790-71-6 | 97% | 139.00 €~480.00 € | Mon 21 Apr 25 |
 | 3,5-Dimethyl-4-formylphenylboronic acid REF: 3D-TYB79071CAS: 1218790-71-6 | Min. 95% | - - - | Discontinued product |
Boronic acid, B-(4-formyl-3,5-dimethylphenyl)-
Ref: IN-DA001699
| 1g | 180.00 € | ||
| 5g | 591.00 € | ||
| 10g | To inquire | ||
| 100mg | 70.00 € | ||
| 250mg | 106.00 € |
Ref: 54-OR360207
| Undefined size | To inquire |
(4-Formyl-3,5-dimethylphenyl)boronic acid
Ref: 10-F694088
| 1g | 139.00 € | ||
| 5g | 480.00 € |
3,5-Dimethyl-4-formylphenylboronic acid
Ref: 3D-TYB79071
| 10mg | Discontinued | Request information | |
| 25mg | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
