CAS 1218790-83-0: B-[3-[[[(Tetrahydro-2-furanyl)methyl]amino]carbonyl]phenyl]boronic acid
Description:B-[3-[[[(Tetrahydro-2-furanyl)methyl]amino]carbonyl]phenyl]boronic acid is a boronic acid derivative characterized by its unique structural features, which include a boron atom bonded to a phenyl group and an amino acid moiety. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the tetrahydro-2-furanyl group suggests potential for interactions with biological systems, possibly enhancing its solubility and reactivity. Additionally, the amino and carbonyl functionalities contribute to its potential as a ligand in coordination chemistry. The compound may also exhibit specific pH-dependent behavior due to the acidic nature of the boronic acid group, influencing its reactivity and stability in different environments. Overall, B-[3-[[[(Tetrahydro-2-furanyl)methyl]amino]carbonyl]phenyl]boronic acid represents a versatile chemical entity with potential applications in drug development and materials science.
Formula:C12H16BNO4
InChI:InChI=1S/C12H16BNO4/c15-12(14-8-11-5-2-6-18-11)9-3-1-4-10(7-9)13(16)17/h1,3-4,7,11,16-17H,2,5-6,8H2,(H,14,15)
InChI key:InChIKey=OBHSWJBFUUNHJE-UHFFFAOYSA-N
SMILES:O=C(NCC1OCCC1)C=2C=CC=C(C2)B(O)O
- Synonyms:
- 3-((Tetrahydrofuran-2-yl)methylcarbamoyl)phenylboronic acid
- B-[3-[[[(Tetrahydro-2-furanyl)methyl]amino]carbonyl]phenyl]boronic acid
- Boronic acid, B-[3-[[[(tetrahydro-2-furanyl)methyl]amino]carbonyl]phenyl]-
- (3-(((Tetrahydrofuran-2-yl)methyl)carbamoyl)phenyl)boronicacid
- (3-(((Tetrahydrofuran-2-yl)methyl)carbamoyl)phenyl)boronic acid

Boronic acid, B-[3-[[[(tetrahydro-2-furanyl)methyl]amino]carbonyl]phenyl]-
Ref: IN-DA0016AA
100mg | 78.00 € | ||
250mg | 106.00 € |

3-((Tetrahydrofuran-2-yl)methylcarbamoyl)phenylboronic acid
Ref: 54-OR361626
1g | 408.00 € | ||
100mg | 104.00 € | ||
250mg | 174.00 € |

(3-(((Tetrahydrofuran-2-yl)methyl)carbamoyl)phenyl)boronic acid
Ref: 10-F694302
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire |

3-((Tetrahydrofuran-2-yl)methylcarbamoyl)phenylboronic acid
Ref: 3D-FT160197
1g | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |