CAS 1218790-88-5

B-[4-(Hydroxymethyl)-3-methylphenyl]boronic acid

Description:

B-[4-(Hydroxymethyl)-3-methylphenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a hydroxymethyl group and a methyl group, contributing to its unique chemical properties. The hydroxymethyl group enhances its solubility in polar solvents and can participate in hydrogen bonding, while the boronic acid moiety allows for applications in organic synthesis, particularly in Suzuki coupling reactions. Additionally, boronic acids are often utilized in medicinal chemistry for drug development due to their ability to interact with biological molecules. The compound's structure suggests potential applications in materials science and as a building block in the synthesis of more complex organic molecules. Its reactivity and functionalization capabilities make it a valuable compound in both academic research and industrial applications.

Formula: C₈H₁₁BO₃

InChI: InChI=1S/C8H11BO3/c1-6-4-8(9(11)12)3-2-7(6)5-10/h2-4,10-12H,5H2,1H3

InChI key: InChIKey=SLIUMAXFJNQYHZ-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(C)=C(CO)C=C1

Synonyms:

• (4-Hydroxymethyl-3-methylbenzene)boronic acid
• B-[4-(Hydroxymethyl)-3-methylphenyl]boronic acid
• Boronic acid, B-[4-(hydroxymethyl)-3-methylphenyl]-
• [4-(Hydroxymethyl)-3-methylphenyl]boronic acid

Boronic acid, B-[4-(hydroxymethyl)-3-methylphenyl]-

CAS: 1218790-88-5

Formula: C₈H₁₁BO₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 165.9821

Ref: IN-DA0016A5

4-Hydroxymethyl-3-methylphenylboronic acid

CAS: 1218790-88-5

4-Hydroxymethyl-3-methylphenylboronic acid

Purity: 98%

Molecular weight: 165.98g/mol

Ref: 54-OR907501

(4-(Hydroxymethyl)-3-methylphenyl)boronic acid

CAS: 1218790-88-5

Formula: C₈H₁₁BO₃

Purity: 96%

Molecular weight: 165.98

Ref: 10-F338072