
CAS 1218790-90-9
:B-[3-[[(4-Chloro-1-naphthalenyl)oxy]methyl]phenyl]boronic acid
Description:
B-[3-[[(4-Chloro-1-naphthalenyl)oxy]methyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a complex structure that includes a naphthalene moiety substituted with a chlorine atom, contributing to its unique chemical properties and potential reactivity. The presence of the boronic acid group allows for applications in various fields, including organic synthesis, medicinal chemistry, and materials science, particularly in the development of sensors and catalysts. Additionally, the compound's ability to participate in Suzuki coupling reactions makes it valuable in the formation of carbon-carbon bonds. Its solubility and stability in different solvents can vary, influencing its practical applications. Overall, B-[3-[[(4-Chloro-1-naphthalenyl)oxy]methyl]phenyl]boronic acid exemplifies the versatility of boronic acids in chemical synthesis and their role in advanced materials development.
Formula:C17H14BClO3
InChI:InChI=1S/C17H14BClO3/c19-16-8-9-17(15-7-2-1-6-14(15)16)22-11-12-4-3-5-13(10-12)18(20)21/h1-10,20-21H,11H2
InChI key:InChIKey=SPRJYGMDTJQRIW-UHFFFAOYSA-N
SMILES:O(CC1=CC(B(O)O)=CC=C1)C=2C3=C(C(Cl)=CC2)C=CC=C3
Synonyms:- B-[3-[[(4-Chloro-1-naphthalenyl)oxy]methyl]phenyl]boronic acid
- Boronic acid, B-[3-[[(4-chloro-1-naphthalenyl)oxy]methyl]phenyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
B-[3-[[(4-Chloro-1-naphthalenyl)oxy]methyl]phenyl]boronic acid
CAS:Formula:C17H14BClO3Molecular weight:312.5553
