CAS 1218791-26-4: 4,4,5,5-Tetramethyl-2-[2-nitro-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane

Description:4,4,5,5-Tetramethyl-2-[2-nitro-5-(trifluoromethyl)phenyl]-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique structural features, including a dioxaborolane ring and a nitro-substituted trifluoromethylphenyl group. This compound typically exhibits a high degree of stability due to the presence of the boron atom, which can participate in various chemical reactions, particularly in organic synthesis and catalysis. The trifluoromethyl group enhances its lipophilicity and can influence its electronic properties, making it useful in medicinal chemistry and materials science. The nitro group may also impart specific reactivity, allowing for further functionalization. Additionally, the presence of multiple methyl groups contributes to steric hindrance, which can affect the compound's reactivity and interactions with other molecules. Overall, this compound's unique combination of functional groups and structural characteristics makes it a valuable candidate for research in various chemical applications, including drug development and the synthesis of complex organic molecules.

Formula:C₁₃H₁₅BF₃NO₄

InChI:InChI=1S/C13H15BF3NO4/c1-11(2)12(3,4)22-14(21-11)9-7-8(13(15,16)17)5-6-10(9)18(19)20/h5-7H,1-4H3

InChI key:InChIKey=YPGBEGMKLJECCM-UHFFFAOYSA-N

SMILES:O=N(=O)C1=CC=C(C=C1B2OC(C)(C)C(O2)(C)C)C(F)(F)F

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-[2-nitro-5-(trifluoromethyl)phenyl]- REF: IN-DA0016ANCAS: 1218791-26-4	- - -	To inquire	Tue 04 Mar 25
2-Nitro-5-trifluoromethylphenylboronic acid, pinacol ester REF: 54-PC412534CAS: 1218791-26-4	- - -	To inquire	Mon 03 Mar 25
4,4,5,5-Tetramethyl-2-(2-nitro-5-(trifluoromethyl)phenyl)-1,3,2-dioxaborolane REF: 10-F767244CAS: 1218791-26-4	98%	- - -	Discontinued product
2-Nitro-5-trifluoroMethylphenylboronic acid, pinacol ester REF: 3D-FN95843CAS: 1218791-26-4	Min. 95%	- - -	Discontinued product