CAS 1218791-47-9: N-Propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine
Description:N-Propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a boron-containing dioxaborolane moiety. The presence of the pyrimidine ring suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as pyrimidines are often found in biologically active compounds. The dioxaborolane group is notable for its ability to participate in various chemical reactions, including those involving boron chemistry, which can enhance the compound's reactivity and stability. This compound may exhibit specific solubility characteristics, depending on the functional groups present, and its molecular interactions could be influenced by the presence of the propyl chain and the bulky tetramethyl substituents. Overall, N-Propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine represents a complex structure with potential utility in synthetic and medicinal applications, warranting further investigation into its properties and reactivity.
Formula:C13H22BN3O2
InChI:InChI=1S/C13H22BN3O2/c1-6-7-15-11-16-8-10(9-17-11)14-18-12(2,3)13(4,5)19-14/h8-9H,6-7H2,1-5H3,(H,15,16,17)
InChI key:InChIKey=AEZSUMXZKXWTDS-UHFFFAOYSA-N
SMILES:N=1C=C(C=NC1NCCC)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- 2-Pyrimidinamine, N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- N-Propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyrimidinamine
- 2-Propylaminopyrimidine-5-boronic acid pinacol ester
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 2-Pyrimidinamine, N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- REF: IN-DA0016BBCAS: 1218791-47-9 | 98% | 109.00 €~572.00 € | Mon 07 Apr 25 |
 | 2-Propylaminopyrimidine-5-boronic acid, pinacol ester REF: 54-OR361563CAS: 1218791-47-9 | - - - | To inquire | Tue 08 Apr 25 |
 | 2-Propylaminopyrimidine-5-boronic acid pinacol ester REF: 10-F696526CAS: 1218791-47-9 | 98% | - - - | Discontinued product |
 | 2-Propylaminopyrimidine-5-boronic acid, pinacol ester REF: 3D-FP160213CAS: 1218791-47-9 | Min. 95% | - - - | Discontinued product |
2-Pyrimidinamine, N-propyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Ref: IN-DA0016BB
| 1g | 186.00 € | ||
| 250mg | 109.00 € |
Ref: 54-OR361563
| Undefined size | To inquire |
2-Propylaminopyrimidine-5-boronic acid pinacol ester
Ref: 10-F696526
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
2-Propylaminopyrimidine-5-boronic acid, pinacol ester
Ref: 3D-FP160213
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
