
CAS 1218792-71-2
:α,α-Dimethyl-2-(trifluoromethyl)benzeneethanamine
Description:
α,α-Dimethyl-2-(trifluoromethyl)benzeneethanamine, identified by its CAS number 1218792-71-2, is a chemical compound characterized by its unique structure, which includes a benzene ring substituted with both a trifluoromethyl group and an ethylamine moiety. This compound features two methyl groups attached to the alpha position of the ethylamine, contributing to its steric properties. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its reactivity and interaction with biological systems. Generally, compounds with such structural features can exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. Additionally, the trifluoromethyl group is known to impart stability and alter the electronic characteristics of the molecule, potentially affecting its behavior in various chemical reactions. As with many amines, α,α-Dimethyl-2-(trifluoromethyl)benzeneethanamine may exhibit basicity and can participate in hydrogen bonding, influencing its solubility and interaction with other chemical species.
Formula:C11H14F3N
InChI:InChI=1S/C11H14F3N/c1-10(2,15)7-8-5-3-4-6-9(8)11(12,13)14/h3-6H,7,15H2,1-2H3
InChI key:InChIKey=HSZVWNUVPAKGJE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(CC(C)(C)N)C=CC=C1
Synonyms:- α,α-Dimethyl-2-(trifluoromethyl)benzeneethanamine
- Benzeneethanamine, α,α-dimethyl-2-(trifluoromethyl)-
- 2-Methyl-1-[2-(trifluoromethyl)phenyl]propan-2-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.