CAS 1218910-62-3

Glutamine, methyl ester, hydrochloride (1:1)

Description:

Glutamine, methyl ester, hydrochloride (1:1) is a derivative of the amino acid glutamine, characterized by the presence of a methyl ester group and a hydrochloride salt form. This compound typically appears as a white to off-white crystalline powder, which is soluble in water due to the presence of the hydrochloride moiety. It is often used in biochemical and pharmaceutical research, particularly in studies related to amino acid metabolism and cellular functions. The methyl ester modification can enhance the compound's lipophilicity, potentially influencing its absorption and bioavailability in biological systems. As a hydrochloride salt, it exhibits stability and ease of handling, making it suitable for various applications in laboratory settings. Additionally, glutamine is known for its role in protein synthesis and as a precursor for neurotransmitters, which may extend the relevance of its methyl ester form in neurobiological studies. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₆H₁₂N₂O₃·ClH

InChI: InChI=1S/C6H12N2O3.ClH/c1-11-6(10)4(7)2-3-5(8)9;/h4H,2-3,7H2,1H3,(H2,8,9);1H

InChI key: InChIKey=HGYBXODOMJPMNO-UHFFFAOYSA-N

SMILES: C(CCC(N)=O)(C(OC)=O)N.Cl

Synonyms:

• Glutamine, methyl ester, hydrochloride (1:1)

Methyl 2-ao-4-carbamoylbutanoate hydrochloride

CAS: 1218910-62-3

Versatile small molecule scaffold

Formula: C₆H₁₃ClN₂O₃

Purity: Min. 95%

Molecular weight: 196.63 g/mol

Ref: 3D-TYB91062