CAS 1218935-60-4

(R)-2-(2,5-DIFLUOROPHENYL)PYRROLIDINE HYDROCHLORIDE

Description:

(R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride is a chiral organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of the 2,5-difluorophenyl group introduces significant steric and electronic effects, influencing the compound's reactivity and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The chirality of the compound suggests that it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of drugs that require enantiomerically pure substances for optimal efficacy and reduced side effects. Its molecular structure and properties can be further explored through techniques such as NMR spectroscopy, mass spectrometry, and X-ray crystallography, which provide insights into its conformation and interactions. Overall, this compound's unique characteristics position it as a valuable candidate for research in various chemical and biological fields.

Formula: C₁₀H₁₂ClF₂N

InChI: InChI=1S/C10H11F2N.ClH/c11-7-3-4-9(12)8(6-7)10-2-1-5-13-10;/h3-4,6,10,13H,1-2,5H2;1H/t10-;/m1./s1

InChI key: InChIKey=XSWCQOVADZHFIJ-HNCPQSOCSA-N

SMILES: FC1=C(C=C(F)C=C1)[C@H]2CCCN2.Cl

Synonyms:

• (2R)-2-(2,5-difluorophenyl)pyrrolidine hydrochloride
• Pyrrolidine, 2-(2,5-difluorophenyl)-, hydrochloride (1:1), (2R)-
• (R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride
• (R)-2-(2,5-Difluorophenyl)pyrrolidene hydrochloride
• (R)-2-(2,5-DIFLUOROPHENYL)PYRROLIDINE HCL

Pyrrolidine, 2-(2,5-difluorophenyl)-, hydrochloride (1:1), (2R)-

CAS: 1218935-60-4

Formula: C₁₀H₁₂ClF₂N

Purity: 97%

Color and Shape: Solid

Molecular weight: 219.6588

Ref: IN-DA0016C1

(R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride

CAS: 1218935-60-4

(R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride

Purity: 95%

Molecular weight: 219.66g/mol

Ref: 54-PC201077

(R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride

CAS: 1218935-60-4

(R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride is a fine chemical that is useful as a building block in the synthesis of complex compounds. It can be used as a reagent or intermediate for the synthesis of other chemical compounds. (R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride is also a versatile building block in organic chemistry due to its ability to react with many different functional groups. As a speciality chemical, it is listed on the Chemical Abstracts Service Registry Number 1218935-60-4.

Formula: C₁₀H₁₂ClF₂N

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 219.66 g/mol

Ref: 3D-FD164770

(R)-2-(2,5-Difluorophenyl)pyrrolidine hydrochloride

CAS: 1218935-60-4

Formula: C₁₀H₁₂ClF₂N

Purity: 97%

Color and Shape: Solid

Molecular weight: 219.66

Ref: 10-F497647