CAS 121898-67-7
:2-(1-Ethylpentyl)-3-oxazolidineethanol
Description:
2-(1-Ethylpentyl)-3-oxazolidineethanol, identified by its CAS number 121898-67-7, is a chemical compound characterized by its oxazolidine ring structure, which contributes to its unique properties. This compound features an ethanol moiety, indicating the presence of a hydroxyl group (-OH) that enhances its solubility in polar solvents. The ethylpentyl substituent introduces hydrophobic characteristics, which can influence its interaction with biological membranes and other organic compounds. Typically, compounds like this may exhibit moderate to low toxicity, but specific safety data should be consulted for handling and usage guidelines. The presence of the oxazolidine ring suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial agents or as intermediates in organic synthesis. Additionally, the compound's structural features may allow for interesting reactivity patterns, making it a candidate for further research in medicinal chemistry and materials science. As with any chemical, proper safety protocols should be followed during handling and experimentation.
Formula:C12H25NO2
InChI:InChI=1S/C12H25NO2/c1-3-5-6-11(4-2)12-13(7-9-14)8-10-15-12/h11-12,14H,3-10H2,1-2H3
InChI key:InChIKey=VIYJONXJODLOMD-UHFFFAOYSA-N
SMILES:C(CCCC)(CC)C1N(CCO)CCO1
Synonyms:- 2-(1-Ethylpentyl)-3-oxazolidineethanol
- 2-(2-Heptan-3-yl-1,3-oxazolidin-3-yl)ethanol
- 3-Oxazolidineethanol, 2-(1-ethylpentyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
