CAS 1218998-90-3
:(2R)-2-(5-Hexen-1-yloxy)propanoic acid
Description:
(2R)-2-(5-Hexen-1-yloxy)propanoic acid is an organic compound characterized by its unique structure, which includes a propanoic acid backbone with a hexenyl ether substituent. This compound features a chiral center at the second carbon, indicating that it exists in a specific stereoisomeric form. The presence of the hexenyl group contributes to its potential reactivity and solubility properties, making it of interest in various chemical applications, including potential use in agrochemicals or pharmaceuticals. The carboxylic acid functional group imparts acidic characteristics, allowing for hydrogen bonding and interactions with other polar molecules. Additionally, the compound's unsaturation from the hexenyl moiety may facilitate further chemical transformations, such as polymerization or cross-coupling reactions. Its molecular structure suggests that it could exhibit biological activity, although specific biological properties would require further investigation. Overall, (2R)-2-(5-Hexen-1-yloxy)propanoic acid represents a versatile compound with potential applications in synthetic chemistry and materials science.
Formula:C9H16O3
InChI:InChI=1S/C9H16O3/c1-3-4-5-6-7-12-8(2)9(10)11/h3,8H,1,4-7H2,2H3,(H,10,11)/t8-/m1/s1
InChI key:InChIKey=AJARURYEKUWTFJ-MRVPVSSYSA-N
SMILES:O([C@@H](C(O)=O)C)CCCCC=C
Synonyms:- (2R)-2-(5-Hexen-1-yloxy)propanoic acid
- Propanoic acid, 2-(5-hexen-1-yloxy)-, (2R)-
- (R)-2-(Hex-5-en-1-yloxy)propanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
