CymitQuimica logo

CAS 1219-05-2

:

ethyl 6,7-dimethyl-3-oxo-3,4-dihydroquinoxaline-2-carboxylate

Description:
Ethyl 6,7-dimethyl-3-oxo-3,4-dihydroquinoxaline-2-carboxylate, with the CAS number 1219-05-2, is a chemical compound belonging to the class of quinoxalines, which are bicyclic compounds containing a fused benzene and pyrazine ring. This substance typically exhibits a yellow to brownish color and is characterized by its distinct functional groups, including a carboxylate ester and a ketone, which contribute to its reactivity and potential applications in organic synthesis. It is soluble in organic solvents, such as ethanol and acetone, but may have limited solubility in water. The compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial and anti-inflammatory properties. Additionally, its structural features make it a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals. As with many organic compounds, proper handling and safety precautions are essential, as it may pose health risks if ingested or inhaled.
Formula:C13H14N2O3
InChI:InChI=1/C13H14N2O3/c1-4-18-13(17)11-12(16)15-10-6-8(3)7(2)5-9(10)14-11/h5-6H,4H2,1-3H3,(H,15,16)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.