CAS 1219020-69-5

2,4-Difluoro-3-(1-methylethoxy)benzoic acid

Description:

2,4-Difluoro-3-(1-methylethoxy)benzoic acid is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with two fluorine atoms and an ethoxy group. The presence of the difluoro substituents at the 2 and 4 positions on the benzene ring enhances its lipophilicity and may influence its reactivity and biological activity. The 1-methylethoxy group introduces steric bulk, which can affect the compound's solubility and interaction with biological targets. As a benzoic acid derivative, it exhibits acidic properties, allowing it to participate in acid-base reactions. The compound's unique combination of functional groups suggests potential applications in pharmaceuticals or agrochemicals, particularly in the development of herbicides or other biologically active agents. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the overall structure, which can be further explored through experimental characterization or computational modeling.

Formula: C₁₀H₁₀F₂O₃

InChI: InChI=1S/C10H10F2O3/c1-5(2)15-9-7(11)4-3-6(8(9)12)10(13)14/h3-5H,1-2H3,(H,13,14)

InChI key: InChIKey=NHOAPOQTLPZFMW-UHFFFAOYSA-N

SMILES: O(C(C)C)C1=C(F)C(C(O)=O)=CC=C1F

Synonyms:

• 2,4-Difluoro-3-isopropoxybenzoic acid
• Benzoic acid, 2,4-difluoro-3-(1-methylethoxy)-
• 2,4-Difluoro-3-(propan-2-yloxy)benzoic acid
• 2,4-Difluoro-3-(1-methylethoxy)benzoic acid