CymitQuimica logo

CAS 1219022-86-2

:

5,6,7,8-Tetrahydro-1,5-naphthyridine-2-carboxylic acid

Description:
5,6,7,8-Tetrahydro-1,5-naphthyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its bicyclic structure, which includes a naphthyridine moiety. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the ring system, contributing to its stability and reactivity. The carboxylic acid functional group (-COOH) attached to the naphthyridine ring enhances its polarity and solubility in polar solvents, making it useful in various chemical reactions and applications. The presence of nitrogen in the ring structure imparts basic properties, allowing it to participate in protonation and coordination with metal ions. This compound may exhibit biological activity, making it of interest in medicinal chemistry for potential pharmaceutical applications. Its unique structural features and functional groups suggest that it could serve as a precursor or intermediate in the synthesis of more complex molecules. As with many organic compounds, its properties can be influenced by factors such as pH, temperature, and the presence of other chemical species.
Formula:C9H10N2O2
InChI:InChI=1S/C9H10N2O2/c12-9(13)8-4-3-6-7(11-8)2-1-5-10-6/h3-4,10H,1-2,5H2,(H,12,13)
InChI key:InChIKey=YIEWEOJZOIDGLZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C2C(=CC1)NCCC2
Synonyms:
  • 5,6,7,8-Tetrahydro-1,5-naphthyridine-2-carboxylic acid
  • 1,5-Naphthyridine-2-carboxylic acid, 5,6,7,8-tetrahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.