CAS 1219080-60-0

B-1H-1,2,4-Triazol-5-ylboronic acid

Description:

B-1H-1,2,4-Triazol-5-ylboronic acid is a boronic acid derivative characterized by its triazole ring structure, which contributes to its unique chemical properties. This compound typically exhibits a white to off-white solid appearance and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid functional group. The triazole moiety enhances its potential for coordination with metal ions, making it useful in various applications, including catalysis and medicinal chemistry. Boronic acids are known for their ability to form reversible covalent bonds with diols, which is significant in biochemical applications, particularly in the development of sensors and drug delivery systems. Additionally, B-1H-1,2,4-Triazol-5-ylboronic acid may exhibit biological activity, making it a candidate for further research in pharmaceuticals. Its stability under ambient conditions and compatibility with various functional groups further enhance its utility in synthetic organic chemistry. Overall, this compound represents a versatile building block in both academic and industrial research settings.

Formula: C₂H₄BN₃O₂

InChI: InChI=1S/C2H4BN3O2/c7-3(8)2-4-1-5-6-2/h1,7-8H,(H,4,5,6)

InChI key: InChIKey=WVTLBJRAZJAABT-UHFFFAOYSA-N

SMILES: B(O)(O)C=1NC=NN1

Synonyms:

• B-1H-1,2,4-Triazol-5-ylboronic acid
• Boronic acid, B-1H-1,2,4-triazol-5-yl-

1H-1,2,4-Triazol-5-ylboronic acid

CAS: 1219080-60-0

Please enquire for more information about 1H-1,2,4-Triazol-5-ylboronic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂H₄BN₃O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 112.89 g/mol

Ref: 3D-UYB08060