CAS 1219112-95-4

Methyl 6-(phenoxymethyl)-2-pyridinecarboxylate

Description:

Methyl 6-(phenoxymethyl)-2-pyridinecarboxylate is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a carboxylate functional group, which contributes to its reactivity and solubility in polar solvents. The presence of the phenoxymethyl group enhances its potential for interactions with biological targets, making it of interest in medicinal chemistry. Typically, compounds like this may exhibit moderate to high lipophilicity due to the aromatic components, influencing their pharmacokinetic properties. The methyl ester group suggests that it can undergo hydrolysis to yield the corresponding carboxylic acid, which may have different biological activities. Additionally, the specific arrangement of substituents on the pyridine ring can affect the compound's electronic properties and reactivity, making it a candidate for various synthetic applications or as a lead compound in drug development. Overall, Methyl 6-(phenoxymethyl)-2-pyridinecarboxylate represents a versatile structure with potential utility in chemical synthesis and biological research.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-17-14(16)13-9-5-6-11(15-13)10-18-12-7-3-2-4-8-12/h2-9H,10H2,1H3

InChI key: InChIKey=FXHOSKBSIFZOQM-UHFFFAOYSA-N

SMILES: C(OC1=CC=CC=C1)C=2N=C(C(OC)=O)C=CC2

Synonyms:

• 2-Pyridinecarboxylic acid, 6-(phenoxymethyl)-, methyl ester
• Methyl 6-(phenoxymethyl)-2-pyridinecarboxylate