CAS 1219130-56-9: 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1(2H)-isoquinolinone
Description:6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1(2H)-isoquinolinone is a chemical compound characterized by its unique structural features, which include an isoquinolinone moiety and a dioxaborolane group. The presence of the dioxaborolane ring contributes to its potential reactivity, particularly in organoboron chemistry, where such compounds are often utilized in cross-coupling reactions and as intermediates in the synthesis of various organic molecules. The tetramethyl substituents enhance the steric bulk around the boron atom, which can influence the compound's reactivity and solubility. This compound may exhibit interesting biological activities due to the isoquinolinone framework, which is known for its presence in various natural products and pharmaceuticals. Additionally, the compound's properties, such as solubility, melting point, and stability, can be influenced by the specific functional groups and their arrangement within the molecular structure. Overall, this compound represents a valuable entity in synthetic organic chemistry and medicinal chemistry research.
Formula:C15H18BNO3
InChI:InChI=1S/C15H18BNO3/c1-14(2)15(3,4)20-16(19-14)11-5-6-12-10(9-11)7-8-17-13(12)18/h5-9H,1-4H3,(H,17,18)
InChI key:InChIKey=ZGNSYBSEZVIFNK-UHFFFAOYSA-N
SMILES:O=C1NC=CC=2C=C(C=CC12)B3OC(C)(C)C(O3)(C)C
- Synonyms:
- 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1(2H)-one
- 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1(2H)-isoquinolinone
- 1(2H)-Isoquinolinone, 6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one
- 6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-ol

6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1(2H)-one
Ref: IN-DA00A9ZW
1g | 203.00 € | ||
5g | To inquire | ||
100mg | 82.00 € | ||
250mg | 111.00 € |

6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1(2H)-one
Ref: 10-F332091
1g | To inquire | ||
2g | To inquire | ||
5g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

6-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2H-isoquinolin-1-one
Ref: 3D-UYB13056
5g | 1,252.00 € | ||
500mg | 408.00 € |