CAS 121915-83-1: 1,4,7,10-tetraazacyclododecane-1,4,7-triacetate, 10-(2-hydroxypropyl)-, calcium salt (1:2)
Description:1,4,7,10-Tetraazacyclododecane-1,4,7-triacetate, 10-(2-hydroxypropyl)-, calcium salt (1:2), commonly referred to as a calcium complex of a tetraazamacrocyclic ligand, exhibits unique characteristics due to its structural composition. This compound features a cyclic structure with four nitrogen atoms and multiple acetate groups, which enhance its solubility and chelating ability. The presence of the 2-hydroxypropyl substituent contributes to its hydrophilicity and potential biological activity. As a calcium salt, it is likely to exhibit properties related to calcium ion coordination, which can influence its stability and reactivity in various environments. This compound may find applications in fields such as medicinal chemistry, where it could serve as a potential drug delivery system or a contrast agent in imaging techniques. Its ability to form stable complexes with metal ions makes it a subject of interest in coordination chemistry and materials science. Overall, the unique structural features and functional groups of this compound contribute to its diverse potential applications.
Formula:C17H29Ca2N4O7
InChI:InChI=1/C17H32N4O7.2Ca/c1-14(22)10-18-2-4-19(11-15(23)24)6-8-21(13-17(27)28)9-7-20(5-3-18)12-16(25)26;;/h14,22H,2-13H2,1H3,(H,23,24)(H,25,26)(H,27,28);;/q;2*+2/p-3

Calciate(1-), [10-[2-(hydroxy-κO)propyl]-1,4,7,10-tetraazacyclododecane-1,4,7-triacetato(3-)-κN1,κN4,κN7,κN10,κO1,κO4,κO7]-, calcium (2:1)
Ref: IN-DA0016EN
Undefined size | To inquire |

Ref: 4Z-C-350001
5mg | To inquire | ||
10mg | To inquire | ||
25mg | To inquire | ||
50mg | To inquire | ||
100mg | To inquire |