CAS 121917-57-5
:(-)-MK-801 MALEATE
Description:
(-)-MK-801 maleate, with the CAS number 121917-57-5, is a potent non-competitive antagonist of the N-methyl-D-aspartate (NMDA) receptor, which plays a crucial role in synaptic plasticity and memory function. This compound is primarily utilized in neuroscience research to study the effects of NMDA receptor inhibition on various neurological conditions, including neurodegenerative diseases and psychiatric disorders. As a maleate salt, it is typically more soluble in water than its base form, facilitating its use in biological experiments. The compound exhibits a high affinity for the NMDA receptor, leading to significant effects on excitatory neurotransmission. Its stereochemistry, indicated by the prefix "(-)", suggests that it is the levorotatory form, which is essential for its biological activity. Due to its potent effects, (-)-MK-801 maleate is often used in animal models to investigate the mechanisms underlying cognitive functions and the potential therapeutic effects of NMDA receptor modulation. However, caution is advised due to its potential neurotoxic effects at high doses.
Formula:C20H19NO4
InChI:InChI=1/C16H15N.C4H4O4/c1-16-13-8-4-2-6-11(13)10-15(17-16)12-7-3-5-9-14(12)16;5-3(6)1-2-4(7)8/h2-9,15,17H,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-,16+;/m1./s1
Synonyms:- (5S,10R)-(-)-5-Methyl-10,11-Dihydro-5H-Dibenzo[A,D]Cyclohepten-5,10-Imine Maleate
- (5S,10R)-5-methyl-10,11-dihydro-5H-5,10-epiminodibenzo[a,d][7]annulene (2E)-but-2-enedioate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
(-)-Dizocilpine maleate
CAS:(-)-Dizocilpine maleate ((-)-MK 801 (Maleate)) is a potent, selective and non-competitive NMDA receptor antagonist with Kd of 37.2 nM in rat brain membranes.Formula:C20H19NO4Purity:>99.99%Color and Shape:White SolidMolecular weight:337.37(-)-MK 801 Maleate
CAS:Controlled ProductApplications (-)-MK 801 Maleate was used in biological study to observe antipsychotics and other agents effects on prepulse inhibition of acoustic startle in rats. Binding properties of (-)-MK 801 Maleate, NMDA receptor channel blocker, were characterized in different brain regions
References Johansson, C, et al.: Pharmacol, Biochem. Behav., 52, 649 (1995); Bresink, I., et al.: Neuropharmacology, 34, 533 (1995);Formula:C16H15N·C4H4O4Color and Shape:NeatMolecular weight:337.4(-)-MK 801 maleate
CAS:NMDA antagonist, less active enantiomerFormula:C16H15N·C4H4O4Purity:Min. 95%Molecular weight:337.37 g/mol




