CAS 121917-57-5: (-)-MK-801 MALEATE
Description:(-)-MK-801 maleate, with the CAS number 121917-57-5, is a potent non-competitive antagonist of the N-methyl-D-aspartate (NMDA) receptor, which plays a crucial role in synaptic plasticity and memory function. This compound is primarily utilized in neuroscience research to study the effects of NMDA receptor inhibition on various neurological conditions, including neurodegenerative diseases and psychiatric disorders. As a maleate salt, it is typically more soluble in water than its base form, facilitating its use in biological experiments. The compound exhibits a high affinity for the NMDA receptor, leading to significant effects on excitatory neurotransmission. Its stereochemistry, indicated by the prefix "(-)", suggests that it is the levorotatory form, which is essential for its biological activity. Due to its potent effects, (-)-MK-801 maleate is often used in animal models to investigate the mechanisms underlying cognitive functions and the potential therapeutic effects of NMDA receptor modulation. However, caution is advised due to its potential neurotoxic effects at high doses.
Formula:C20H19NO4
InChI:InChI=1/C16H15N.C4H4O4/c1-16-13-8-4-2-6-11(13)10-15(17-16)12-7-3-5-9-14(12)16;5-3(6)1-2-4(7)8/h2-9,15,17H,10H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-,16+;/m1./s1
- Synonyms:
- (5S,10R)-(-)-5-Methyl-10,11-Dihydro-5H-Dibenzo[A,D]Cyclohepten-5,10-Imine Maleate
- (5S,10R)-5-methyl-10,11-dihydro-5H-5,10-epiminodibenzo[a,d][7]annulene (2E)-but-2-enedioate
