
CAS 121924-05-8
:Capsianoside III
Description:
Capsianoside III, with the CAS number 121924-05-8, is a glycoside compound primarily derived from Capsicum species, particularly chili peppers. It belongs to a class of compounds known for their potential health benefits, including anti-inflammatory and antioxidant properties. Capsianoside III is characterized by its complex structure, which typically includes a sugar moiety linked to a phenolic or aglycone part, contributing to its biological activity. This compound is often studied for its role in enhancing the pungency and flavor profile of peppers, as well as its potential therapeutic effects. Research indicates that capsianosides may influence metabolic processes and exhibit protective effects against certain diseases. Additionally, Capsianoside III may contribute to the overall sensory experience of consuming spicy foods, making it of interest not only in pharmacology but also in food science. Its stability and solubility in various solvents can vary, impacting its extraction and application in both culinary and medicinal contexts.
Formula:C50H84O26
InChI:InChI=1S/C50H84O26/c1-7-50(6,76-49-44(38(62)33(57)28(19-53)72-49)75-47-42(66)37(61)32(56)27(18-52)71-47)16-10-15-23(3)12-8-11-22(2)13-9-14-24(4)20-67-48-43(74-46-41(65)36(60)31(55)26(17-51)70-46)39(63)34(58)29(73-48)21-68-45-40(64)35(59)30(54)25(5)69-45/h7,11,14-15,25-49,51-66H,1,8-10,12-13,16-21H2,2-6H3/b22-11+,23-15+,24-14-/t25-,26+,27+,28+,29+,30-,31+,32+,33+,34+,35+,36-,37-,38-,39-,40+,41+,42+,43+,44+,45+,46-,47-,48+,49-,50+/m0/s1
InChI key:InChIKey=JHLMLCRVDVBIAC-VYLSVUCZSA-N
SMILES:O([C@@](CC/C=C(/CC/C=C(/CC/C=C(\CO[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@@H](CO[C@H]3[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O3)O1)/C)\C)\C)(C=C)C)[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO)O4
Synonyms:- Capsianoside III
- β-D-Glucopyranoside, (1S,4E,8E,12Z)-14-[(O-6-deoxy-α-L-mannopyranosyl-(1→6)-O-[β-D-glucopyranosyl-(1→2)]-β-D-glucopyranosyl)oxy]-1-ethenyl-1,5,9,13-tetramethyl-4,8,12-tetradecatrien-1-yl 2-O-β-D-glucopyranosyl-
- β-D-Glucopyranoside, (1S,4E,8E,12Z)-14-[(O-6-deoxy-α-L-mannopyranosyl-(1→6)-O-[β-D-glucopyranosyl-(1→2)]-β-D-glucopyranosyl)oxy]-1-ethenyl-1,5,9,13-tetramethyl-4,8,12-tetradecatrienyl 2-O-β-D-glucopyranosyl-
- (1S,4E,8E,12Z)-14-[(O-6-Deoxy-α-L-mannopyranosyl-(1→6)-O-[β-D-glucopyranosyl-(1→2)]-β-D-glucopyranosyl)oxy]-1-ethenyl-1,5,9,13-tetramethyl-4,8,12-tetradecatrien-1-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Capsianoside III
CAS:<p>Capsianoside III is a useful organic compound for research related to life sciences. The catalog number is T126200 and the CAS number is 121924-05-8.</p>Formula:C50H84O26Color and Shape:SolidMolecular weight:1101.2
