CymitQuimica logo

CAS 121933-76-4

:

N-HYDROXY-2-PHENYL-1-HYDRAZINECARBOXAMIDE

Description:
N-Hydroxy-2-phenyl-1-hydrazinecarboxamide, with the CAS number 121933-76-4, is a chemical compound characterized by its hydrazine and carboxamide functional groups. It typically appears as a solid and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the N-hydroxy group suggests it may exhibit reactivity that can be harnessed in various chemical reactions, including those involving nitrosation or as a potential antioxidant. Its phenyl group contributes to its hydrophobic characteristics, which can influence its solubility and interaction with biological systems. The compound may also exhibit biological activity, making it of interest in research related to cancer treatment or other therapeutic areas. As with many hydrazine derivatives, safety precautions are necessary due to potential toxicity and reactivity. Overall, N-hydroxy-2-phenyl-1-hydrazinecarboxamide represents a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C7H9N3O2
InChI:InChI=1/C7H9N3O2/c11-7(10-12)9-8-6-4-2-1-3-5-6/h1-5,8,12H,(H2,9,10,11)
SMILES:c1ccc(cc1)NN=C(NO)O
Synonyms:
  • N-Hydro-2-phenyl-1-hydrazinecarboxamide
  • N-hydroxy-2-phenylhydrazinecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.