CymitQuimica logo

CAS 121935-03-3

:

6-difluoromethoxy-7-piperazinyl-3-quinolonecarboxylic acid

Description:
6-Difluoromethoxy-7-piperazinyl-3-quinolonecarboxylic acid is a synthetic chemical compound belonging to the class of quinolone derivatives, which are known for their antibacterial properties. This compound features a quinolone core structure, characterized by a bicyclic system containing a nitrogen atom, which contributes to its biological activity. The presence of the difluoromethoxy group enhances its pharmacological profile, potentially improving its efficacy and selectivity against bacterial targets. The piperazinyl moiety is often associated with increased solubility and bioavailability, making it a valuable component in drug design. Additionally, the carboxylic acid functional group may play a crucial role in the compound's interaction with biological systems, influencing its acid-base properties and reactivity. Overall, this compound is of interest in medicinal chemistry, particularly in the development of new antimicrobial agents. Its specific characteristics, such as solubility, stability, and interaction with biological targets, would be essential for evaluating its potential therapeutic applications.
Formula:C15H15F2N3O4
InChI:InChI=1/C15H15F2N3O4/c16-15(17)24-12-5-8-10(19-7-9(13(8)21)14(22)23)6-11(12)20-3-1-18-2-4-20/h5-7,15,18H,1-4H2,(H,19,21)(H,22,23)
SMILES:C1CN(CCN1)c1cc2c(cc1OC(F)F)c(=O)c(c[nH]2)C(=O)O
Synonyms:
  • Dfmpq
  • 3-Quinolinecarboxylic acid, 6-(difluoromethoxy)-1,4-dihydro-4-oxo-7-(1-piperazinyl)-
  • 6-(Difluoromethoxy)-4-Oxo-7-(Piperazin-1-Yl)-1,4-Dihydroquinoline-3-Carboxylic Acid
  • 6-Difluoromethoxy-7-piperazinyl-3-quinolonecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.