
CAS 1219454-90-6
:5-[(Difluoromethyl)sulfonyl]-1-phenyl-1H-tetrazole
Description:
5-[(Difluoromethyl)sulfonyl]-1-phenyl-1H-tetrazole is a chemical compound characterized by its unique structure, which includes a tetrazole ring and a difluoromethylsulfonyl group. The presence of the tetrazole moiety imparts notable properties, such as potential biological activity and stability under various conditions. The difluoromethylsulfonyl group enhances the compound's reactivity and may influence its solubility and polarity, making it suitable for various applications in medicinal chemistry and agrochemicals. This compound is likely to exhibit interesting interactions with biological targets due to the presence of both electron-withdrawing and electron-donating groups. Its molecular structure suggests potential uses in the development of pharmaceuticals or as a building block in organic synthesis. Additionally, the presence of fluorine atoms can enhance metabolic stability and bioavailability. Overall, 5-[(Difluoromethyl)sulfonyl]-1-phenyl-1H-tetrazole is a compound of interest for further research and development in chemical and pharmaceutical sciences.
Formula:C8H6F2N4O2S
InChI:InChI=1S/C8H6F2N4O2S/c9-7(10)17(15,16)8-11-12-13-14(8)6-4-2-1-3-5-6/h1-5,7H
InChI key:InChIKey=WNLSBPHEZWSKQL-UHFFFAOYSA-N
SMILES:S(C(F)F)(=O)(=O)C=1N(N=NN1)C2=CC=CC=C2
Synonyms:- 5-[(Difluoromethyl)sulfonyl]-1-phenyl-1H-tetrazole
- 1H-Tetrazole, 5-[(difluoromethyl)sulfonyl]-1-phenyl-
- 1-Phenyl-1H-tetrazol-5-yl difluoromethyl sulfone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.