CAS 1219455-78-3
:Benzenemethanamine, 2-fluoro-α-(2-methylpropyl)-, hydrochloride (1:1)
Description:
Benzenemethanamine, 2-fluoro-α-(2-methylpropyl)-, hydrochloride (1:1), with the CAS number 1219455-78-3, is a chemical compound characterized by its amine functional group and a fluorinated aromatic structure. This compound features a benzene ring substituted with a methanamine group and a 2-fluoro-α-(2-methylpropyl) moiety, which contributes to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The presence of the fluorine atom can influence the compound's reactivity, stability, and biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which may be explored for therapeutic purposes. Safety and handling precautions should be observed due to the potential toxicity associated with amines and halogenated compounds. Overall, this substance represents a specific class of organic compounds with applications in chemical synthesis and drug development.
Formula:C11H16FN·ClH
InChI:InChI=1S/C11H16FN.ClH/c1-8(2)7-11(13)9-5-3-4-6-10(9)12;/h3-6,8,11H,7,13H2,1-2H3;1H
InChI key:InChIKey=NMYVSKKUJLBHFS-UHFFFAOYSA-N
SMILES:C(CC(C)C)(N)C1=C(F)C=CC=C1.Cl
Synonyms:- Benzenemethanamine, 2-fluoro-α-(2-methylpropyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
