
CAS 1219484-98-6
:1-Desoxymethylsphinganine
Description:
1-Desoxymethylsphinganine, also known as DMS, is a sphingolipid derivative characterized by its structural features that include a long-chain amino alcohol backbone. This compound is notable for its role in cellular signaling and membrane structure, particularly in the context of sphingolipid metabolism. It is a bioactive molecule that can influence various biological processes, including cell growth, differentiation, and apoptosis. The presence of a hydroxyl group and a long hydrophobic tail contributes to its amphipathic nature, allowing it to integrate into lipid bilayers. Additionally, 1-desoxymethylsphinganine has been studied for its potential therapeutic applications, particularly in cancer research, due to its ability to modulate cell signaling pathways. Its synthesis typically involves complex organic reactions, and it can be analyzed using techniques such as mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. Overall, this compound represents an important area of study within biochemistry and pharmacology, highlighting the intricate roles of sphingolipids in health and disease.
Formula:C17H37NO
InChI:InChI=1S/C17H37NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17(19)16-18/h17,19H,2-16,18H2,1H3/t17-/m1/s1
InChI key:InChIKey=UGVBFHUWZNNKIK-QGZVFWFLSA-N
SMILES:C(CCCCCCCCCCC)CCC[C@H](CN)O
Synonyms:- 1-Desoxymethylsphinganine
- (2R)-1-Amino-2-heptadecanol
- 2-Heptadecanol, 1-amino-, (2R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.