CAS 121952-97-4

5-BENZYL-1,3-THIAZOL-2-AMINE

Description:

5-Benzyl-1,3-thiazol-2-amine is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. The presence of a benzyl group enhances its aromatic properties and may influence its reactivity and solubility. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can affect its interactions in biological systems. It may also display moderate to high lipophilicity due to the benzyl substituent, potentially impacting its pharmacokinetics if considered for medicinal applications. The thiazole moiety is often found in various bioactive compounds, suggesting that 5-benzyl-1,3-thiazol-2-amine could have potential biological activity, although specific studies would be necessary to elucidate its pharmacological properties. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and safety data should be consulted for handling due to the presence of amine functionalities.

Formula: C₁₀H₁₀N₂S

InChI: InChI=1/C10H10N2S/c11-10-12-7-9(13-10)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,11,12)

SMILES: c1ccc(cc1)Cc1c[nH]c(=N)s1

Synonyms:

• 2-Thiazolamine, 5-(Phenylmethyl)-
• 5-Benzyl-1,3-thiazol-2-amine

5-Benzyl-thiazol-2-ylamine

CAS: 121952-97-4

Formula: C₁₀H₁₀N₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 190.2648

Ref: IN-DA0016GN

5-Benzyl-thiazol-2-ylamine

CAS: 121952-97-4

5-Benzyl-thiazol-2-ylamine

Purity: 95%

Molecular weight: 190.26g/mol

Ref: 54-OR953871

5-Benzylthiazol-2-amine

CAS: 121952-97-4

Purity: 97%

Molecular weight: 190.26

Ref: 10-F767258

5-Benzyl-thiazol-2-ylamine

CAS: 121952-97-4

5-Benzyl-thiazol-2-ylamine is a nitrogenous compound that has been shown to interact with ferrite, a magnetic material. It has proapoptotic effects on human glioblastoma cells, t98g cells, and mouse fibroblasts. The interactions of 5-benzyl-thiazol-2-ylamine with ferrite are reportedly stabilized by the presence of iron ions. This interaction can be studied using resonance energy techniques such as fluorescence microscopy, nuclear magnetic resonance spectroscopy, and electron paramagnetic resonance spectroscopy.

Formula: C₁₀H₁₀N₂S

Purity: Min. 95%

Molecular weight: 190.26 g/mol

Ref: 3D-WEA95297