CymitQuimica logo

CAS 1219636-66-4

:

1H-Pyrazolo[3,4-d]pyrimidine, 3-iodo-1-methyl-

Description:
1H-Pyrazolo[3,4-d]pyrimidine, 3-iodo-1-methyl- is a heterocyclic organic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. The presence of the iodine atom at the 3-position and a methyl group at the 1-position enhances its reactivity and potential applications in medicinal chemistry. This compound typically exhibits a solid-state at room temperature and is soluble in polar organic solvents. Its structure allows for various interactions, making it a candidate for biological activity, particularly in the development of pharmaceuticals. The compound may also participate in nucleophilic substitution reactions due to the presence of the iodine atom, which can be displaced under appropriate conditions. Additionally, its heterocyclic nature may influence its electronic properties, making it useful in the design of materials or as a building block in organic synthesis. Overall, 1H-Pyrazolo[3,4-d]pyrimidine, 3-iodo-1-methyl- is of interest for its potential applications in drug discovery and development.
Formula:C6H5IN4
InChI:InChI=1S/C6H5IN4/c1-11-6-4(5(7)10-11)2-8-3-9-6/h2-3H,1H3
InChI key:InChIKey=AIOBPNSEERHGOU-UHFFFAOYSA-N
SMILES:IC=1C=2C(N(C)N1)=NC=NC2
Synonyms:
  • 1H-Pyrazolo[3,4-d]pyrimidine, 3-iodo-1-methyl-
  • 3-Iodo-1-methyl-1H-pyrazolo[3,4-d]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.