CymitQuimica logo

CAS 1219637-80-5

:

5-Bromo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole

Description:
5-Bromo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole is a chemical compound characterized by its indole core, which is a bicyclic structure containing a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 5-position enhances its reactivity and potential for further functionalization. The compound also features a boron-containing moiety, specifically a dioxaborolane, which is known for its utility in organic synthesis, particularly in cross-coupling reactions and as a boron source in various transformations. The tetramethyl substitution on the dioxaborolane contributes to the compound's stability and solubility properties. This compound may exhibit interesting biological activities due to the indole structure, which is prevalent in many natural products and pharmaceuticals. Its unique combination of functional groups makes it a valuable intermediate in synthetic organic chemistry, particularly in the development of new materials or biologically active compounds. As with many organoboron compounds, it may also participate in reactions such as Suzuki coupling, making it relevant in the field of medicinal chemistry and materials science.
Formula:C14H17BBrNO2
InChI:InChI=1S/C14H17BBrNO2/c1-13(2)14(3,4)19-15(18-13)11-8-10(16)7-9-5-6-17-12(9)11/h5-8,17H,1-4H3
InChI key:InChIKey=XSLCNVSLHIGMRI-UHFFFAOYSA-N
SMILES:BrC1=CC(=C2C(=C1)C=CN2)B3OC(C)(C)C(C)(C)O3
Synonyms:
  • 5-Bromo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole
  • 1H-Indole, 5-bromo-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.