CAS 1219708-11-8

N-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluoro-4-nitrobenzenamine

Description:

N-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluoro-4-nitrobenzenamine is a chemical compound characterized by its complex structure, which includes a fluoro group, a nitro group, and a silyl ether moiety. The presence of the dimethylethyl group contributes to its hydrophobic properties, while the nitro and fluoro substituents can enhance its reactivity and polarity. This compound is likely to exhibit moderate to high stability under standard conditions, but its reactivity may increase in the presence of strong nucleophiles or under acidic or basic conditions. The silyl ether functionality suggests potential applications in organic synthesis, particularly in protecting groups or as intermediates in the preparation of more complex molecules. Additionally, the compound's unique structure may impart specific biological activities, making it of interest in pharmaceutical research. However, detailed studies would be necessary to fully understand its properties, reactivity, and potential applications in various fields, including materials science and medicinal chemistry.

Formula: C₁₄H₂₃FN₂O₃Si

InChI: InChI=1S/C14H23FN2O3Si/c1-14(2,3)21(4,5)20-9-8-16-13-7-6-11(17(18)19)10-12(13)15/h6-7,10,16H,8-9H2,1-5H3

InChI key: InChIKey=ACXLORVZGOLDAI-UHFFFAOYSA-N

SMILES: N(CCO[Si](C(C)(C)C)(C)C)C1=C(F)C=C(N(=O)=O)C=C1

Synonyms:

• N-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluoro-4-nitrobenzenamine
• Benzenamine, N-[2-[[(1,1-dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluoro-4-nitro-

N-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluoro-4-nitro-benzenamine

Controlled Product

CAS: 1219708-11-8

Applications N-[2-[[(1,1-Dimethylethyl)dimethylsilyl]oxy]ethyl]-2-fluoro-4-nitro-benzenamine is an intermediate in the synthesis of PNU 142586 Sodium Salt, which is an inactive metabolite of Linezolid (L466500).
References Shinabarger, D., et al.: Antimicrob. Agents Chemother., 41, 2132 (1997), Wynalda, M., et al.: Drug Metab. Dispos., 28, 1014 (2000),

Formula: C₁₄H₂₃FN₂O₃Si

Color and Shape: Neat

Molecular weight: 314.43

Ref: TR-D479870