CAS 1219730-72-9

4-Bromo-2-(2-methoxyethoxy)benzenamine

Description:

4-Bromo-2-(2-methoxyethoxy)benzenamine is an organic compound characterized by its aromatic structure, which includes a bromine substituent and an amine functional group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and solubility. The methoxyethoxy group enhances the compound's solubility in organic solvents and may also affect its interaction with biological systems. This compound is likely to exhibit moderate polarity due to the combination of the hydrophobic aromatic ring and the hydrophilic ether and amine functionalities. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the amine group can participate in hydrogen bonding and other interactions with biological targets. Additionally, the compound may undergo various chemical reactions typical of amines and aromatic compounds, such as electrophilic substitution or nucleophilic reactions, making it a versatile building block in organic synthesis. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₉H₁₂BrNO₂

InChI: InChI=1S/C9H12BrNO2/c1-12-4-5-13-9-6-7(10)2-3-8(9)11/h2-3,6H,4-5,11H2,1H3

InChI key: InChIKey=JMHZROHRIISRKH-UHFFFAOYSA-N

SMILES: O(CCOC)C1=C(N)C=CC(Br)=C1

Synonyms:

• 4-Bromo-2-(2-methoxyethoxy)benzenamine
• Benzenamine, 4-bromo-2-(2-methoxyethoxy)-