CymitQuimica logo

CAS 1219737-10-6

:

B-[5-(2-Methoxyphenyl)-3-pyridinyl]boronic acid

Description:
B-[5-(2-Methoxyphenyl)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a methoxyphenyl group, contributing to its potential applications in medicinal chemistry and organic synthesis. The boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the presence of the methoxy group can influence the compound's solubility and reactivity, while the pyridine ring may enhance its biological activity. Overall, this compound is of interest in the development of pharmaceuticals and agrochemicals, as well as in materials science for the synthesis of complex organic structures. Its unique structural features and reactivity profile make it a subject of study in various chemical research fields.
Formula:C12H12BNO3
InChI:InChI=1S/C12H12BNO3/c1-17-12-5-3-2-4-11(12)9-6-10(13(15)16)8-14-7-9/h2-8,15-16H,1H3
InChI key:InChIKey=AXFUAQNFVODSRT-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=2C=C(B(O)O)C=NC2)C=CC=C1
Synonyms:
  • Boronic acid, B-[5-(2-methoxyphenyl)-3-pyridinyl]-
  • [5-(2-Methoxyphenyl)pyridin-3-yl]boronic acid
  • B-[5-(2-Methoxyphenyl)-3-pyridinyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.