CymitQuimica logo

CAS 1219741-22-6

:

5-Chloro-6-iodo-2-(methylthio)-1H-benzimidazole

Description:
5-Chloro-6-iodo-2-(methylthio)-1H-benzimidazole is a heterocyclic organic compound characterized by its benzimidazole core, which features a chlorine atom at the 5-position and an iodine atom at the 6-position. The presence of a methylthio group at the 2-position contributes to its unique chemical properties and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents, due to the presence of halogen substituents that can enhance biological activity. The compound's reactivity may be influenced by the electron-withdrawing nature of the chlorine and iodine atoms, which can affect its interaction with biological targets. Additionally, the methylthio group may enhance lipophilicity, influencing the compound's pharmacokinetic properties. As with many halogenated compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C8H6ClIN2S
InChI:InChI=1S/C8H6ClIN2S/c1-13-8-11-6-2-4(9)5(10)3-7(6)12-8/h2-3H,1H3,(H,11,12)
InChI key:InChIKey=MZRYEOHHJIRTFJ-UHFFFAOYSA-N
SMILES:S(C)C=1NC=2C(N1)=CC(I)=C(Cl)C2
Synonyms:
  • 6-Chloro-5-iodo-2-(methylthio)-1H-benzimidazole
  • 1H-Benzimidazole, 5-chloro-6-iodo-2-(methylthio)-
  • 5-Chloro-6-iodo-2-(methylthio)-1H-benzimidazole
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.