CAS 1219741-52-2

4-Bromo-7-(1-methylethyl)-1H-indole

Description:

4-Bromo-7-(1-methylethyl)-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 4-position and an isopropyl group at the 7-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It is often used in research and development, particularly in the fields of medicinal chemistry and organic synthesis, due to its potential biological activity and ability to serve as a building block for more complex molecules. The bromine substituent can enhance reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Bromo-7-(1-methylethyl)-1H-indole is a valuable compound in synthetic organic chemistry with potential applications in pharmaceuticals.

Formula: C₁₁H₁₂BrN

InChI: InChI=1S/C11H12BrN/c1-7(2)8-3-4-10(12)9-5-6-13-11(8)9/h3-7,13H,1-2H3

InChI key: InChIKey=NDLDXNCOVYZHHV-UHFFFAOYSA-N

SMILES: C(C)(C)C1=C2C(=C(Br)C=C1)C=CN2

Synonyms:

• 1H-Indole, 4-bromo-7-(1-methylethyl)-
• 4-Bromo-7-(1-methylethyl)-1H-indole

4-Bromo-7-(propan-2-yl)-1H-indole

CAS: 1219741-52-2

Versatile small molecule scaffold

Formula: C₁₁H₁₂BrN

Purity: Min. 95%

Molecular weight: 238.12 g/mol

Ref: 3D-UYB74152