CAS 1219794-58-7

Hexanoic-3,3,4,4,5,5-d6 acid, 6-hydroxy-, sodium salt (1:1)

Description:

Hexanoic-3,3,4,4,5,5-d6 acid, 6-hydroxy-, sodium salt (1:1) is a deuterated derivative of hexanoic acid, which is a medium-chain fatty acid. The presence of deuterium atoms (d6) indicates that this compound has been isotopically labeled, making it useful in various analytical applications, particularly in NMR spectroscopy. The sodium salt form suggests that the compound is ionized, enhancing its solubility in aqueous solutions. This compound features a hydroxyl group at the 6-position, which can influence its reactivity and interaction with biological systems. As a sodium salt, it is likely to exhibit properties typical of carboxylate salts, such as increased solubility in water compared to its acid form. The presence of multiple deuterium atoms can also affect the compound's physical properties, such as boiling and melting points, compared to its non-deuterated counterpart. Overall, this compound is of interest in both synthetic chemistry and biochemical research, particularly in studies involving metabolic pathways and tracer studies.

Formula: C₆H₆D₆O₃·Na

InChI: InChI=1S/C6H12O3.Na/c7-5-3-1-2-4-6(8)9;/h7H,1-5H2,(H,8,9);/i1D2,2D2,3D2;

InChI key: InChIKey=RECSGXMAOMHKMW-LRDWTYOMSA-N

SMILES: C(CC(O)=O)(C(C(CO)([2H])[2H])([2H])[2H])([2H])[2H].[Na]

Synonyms:

• Hexanoic-3,3,4,4,5,5-d6 acid, 6-hydroxy-, sodium salt (1:1)

Sodium 6-Hydroxyhexanoate-3,3,4,4,5,5-d6

CAS: 1219794-58-7

Formula: HOCH₂CD₂CD₂CD₂CH₂COONa

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 160.09825

Ref: 3U-D6106

Sodium 6-Hydroxyhexanoate-3,3,4,4,5,5-d6

Controlled Product

CAS: 1219794-58-7

Applications Sodium 6-Hydroxyhexanoate-3,3,4,4,5,5-d6 (CAS# 1219794-58-7) is a useful isotopically labeled research compound.

Formula: C₆H₅D₆NaO₃

Color and Shape: Neat

Molecular weight: 160.18

Ref: TR-S529961