CAS 1219795-54-6

Benzene-1,2,4-d3, 5-bromo-3,6-difluoro-

Description:

Benzene-1,2,4-d3, 5-bromo-3,6-difluoro- is a halogenated aromatic compound characterized by its unique substitution pattern on the benzene ring. The presence of three deuterium atoms (d3) indicates that it is a labeled compound, which can be useful in various analytical and research applications, particularly in tracing studies. The bromine and fluorine substituents contribute to its reactivity and influence its physical properties, such as boiling and melting points, as well as its solubility in different solvents. The bromine atom typically enhances the compound's electrophilic character, while the fluorine atoms can impart unique electronic properties due to their high electronegativity. This compound may be of interest in fields such as medicinal chemistry, materials science, and environmental studies, where understanding the behavior of halogenated compounds is crucial. Its specific applications would depend on the context of its use, including potential roles in synthesis or as a precursor in various chemical reactions.

Formula: C₆BrD₃F₂

InChI: InChI=1S/C6H3BrF2/c7-5-3-4(8)1-2-6(5)9/h1-3H/i1D,2D,3D

InChI key: InChIKey=XCRCSPKQEDMVBO-CBYSEHNBSA-N

SMILES: BrC1=C(F)C(=C(C(F)=C1[2H])[2H])[2H]

Synonyms:

• Benzene-1,2,4-d3, 5-bromo-3,6-difluoro-

1-Bromo-2,5-difluorobenzene-d3

CAS: 1219795-54-6

Formula: BrC₆D₃F₂

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 194.95745

Ref: 3U-D6473

1-Bromo-2,5-difluorobenzene-d3

Controlled Product

CAS: 1219795-54-6

Applications 1-Bromo-2,5-difluorobenzene-d3 (CAS# 1219795-54-6) is a useful isotopically labeled research compound.

Formula: C₆D₃BrF₂

Color and Shape: Neat

Molecular weight: 196.01

Ref: TR-B689649