CAS 1219799-05-9

3,5-Dibromopyridine-2,4,6-d3

Description:

3,5-Dibromopyridine-2,4,6-d3 is a deuterated derivative of dibromopyridine, characterized by the presence of bromine atoms at the 3 and 5 positions of the pyridine ring, along with deuterium (d3) substitutions at the 2, 4, and 6 positions. This compound is typically used in research and development, particularly in studies involving isotopic labeling, which can help in tracing reaction pathways or understanding mechanisms in organic chemistry. The presence of bromine atoms contributes to its reactivity, making it useful in various synthetic applications, including the formation of more complex organic molecules. The deuterium labeling can also enhance NMR spectroscopy analysis, providing clearer insights into molecular dynamics. As a pyridine derivative, it exhibits basic properties typical of nitrogen-containing heterocycles, and its solubility and stability can vary depending on the solvent and conditions used. Overall, 3,5-Dibromopyridine-2,4,6-d3 serves as a valuable tool in both synthetic and analytical chemistry.

Formula: C₅Br₂D₃N

InChI: InChI=1S/C5H3Br2N/c6-4-1-5(7)3-8-2-4/h1-3H/i1D,2D,3D

InChI key: InChIKey=SOSPMXMEOFGPIM-CBYSEHNBSA-N

SMILES: BrC=1C(=C(Br)C(=NC1[2H])[2H])[2H]

Synonyms:

• Pyridine-2,4,6-d3, 3,5-dibromo-
• 3,5-Dibromopyridine-2,4,6-d3

3,5-Dibromopyridine-d3

CAS: 1219799-05-9

Formula: C₅D₃Br₂N

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 237.88205

Ref: 3U-D5737

3,5-Dibromopyridine-d3

Controlled Product

CAS: 1219799-05-9

Applications 3,5-Dibromopyridine-d3 (CAS# 1219799-05-9) is a useful isotopically labeled research compound.

Formula: C₅D₃Br₂N

Color and Shape: Neat

Molecular weight: 239.91

Ref: TR-D425474