CAS 1219799-07-1

6-Hexylbenzene-1,2,3,4,5-d5

Description:

6-Hexylbenzene-1,2,3,4,5-d5 is a deuterated derivative of hexylbenzene, where the benzene ring is substituted with a hexyl group and all five hydrogen atoms on the benzene ring are replaced with deuterium isotopes. This compound is characterized by its unique isotopic labeling, which enhances its utility in various analytical techniques, particularly in nuclear magnetic resonance (NMR) spectroscopy. The presence of deuterium can improve the resolution of NMR spectra and reduce the background noise, making it valuable in studying molecular dynamics and interactions. Additionally, the hexyl group contributes to the hydrophobic nature of the molecule, influencing its solubility and reactivity in organic solvents. As a chemical substance, it may be used in research applications, including studies on aromatic compounds and their derivatives, as well as in the development of materials with specific properties. Its CAS number, 1219799-07-1, allows for precise identification and cataloging in chemical databases.

Formula: C₁₂H₁₃D₅

InChI: InChI=1S/C12H18/c1-2-3-4-6-9-12-10-7-5-8-11-12/h5,7-8,10-11H,2-4,6,9H2,1H3/i5D,7D,8D,10D,11D

InChI key: InChIKey=LTEQMZWBSYACLV-SIHPLOMNSA-N

SMILES: C(CCCCC)C1=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H]

Synonyms:

• 6-Hexylbenzene-1,2,3,4,5-d5
• Benzene-1,2,3,4,5-d5, 6-hexyl-

n-Hexylbenzene-2,3,4,5,6-d5

CAS: 1219799-07-1

Formula: C₆D₅(CH₂)₅CH₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 167.17223

Ref: 3U-D6733

n-Hexylbenzene-2,3,4,5,6-d5

Controlled Product

CAS: 1219799-07-1

Applications n-Hexylbenzene-2,3,4,5,6-d5 (CAS# 1219799-07-1) is a useful isotopically labeled research compound.

Formula: C₁₂H₁₃D₅

Color and Shape: Neat

Molecular weight: 167.31

Ref: TR-H298191