CAS 1219803-49-2

TRIMETHYL ORTHOPROPIONATE-2,2,3,3,3-D5

Description:

Trimethyl orthopropionate-2,2,3,3,3-D5 is a deuterated derivative of trimethyl orthopropionate, which is an ester commonly used in organic synthesis and as a solvent. The presence of deuterium (D5) indicates that this compound contains five deuterium atoms, which are isotopes of hydrogen. This substitution can significantly alter the physical and chemical properties of the compound, such as its boiling point, solubility, and reactivity, compared to its non-deuterated counterpart. Deuterated compounds are often utilized in NMR spectroscopy and other analytical techniques due to their unique spectral characteristics. Trimethyl orthopropionate itself is characterized by its relatively low viscosity and volatility, making it useful in various chemical reactions, particularly in the synthesis of other organic compounds. The specific application of this deuterated version may include studies in reaction mechanisms or as a tracer in metabolic studies. As with all chemical substances, proper handling and safety precautions should be observed, given its potential hazards.

Formula: C₆H₉D₅O₃

InChI: InChI=1S/C6H14O3/c1-5-6(7-2,8-3)9-4/h5H2,1-4H3/i1D3,5D2

InChI key: InChIKey=ZGMNAIODRDOMEK-RPIBLTHZSA-N

SMILES: C(C(C([2H])([2H])[2H])([2H])[2H])(OC)(OC)OC

Synonyms:

• TRIMETHYL ORTHOPROPIONATE-2,2,3,3,3-D5

Trimethyl Orthopropionate-2,2,3,3,3-d5

CAS: 1219803-49-2

Formula: CD₃CD₂C(OCH₃)₃

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 139.12568

Ref: 3U-D6580

Trimethyl Orthopropionate-2,2,3,3,3-d5

Controlled Product

CAS: 1219803-49-2

Applications Trimethyl Orthopropionate-2,2,3,3,3-d5 (CAS# 1219803-49-2) is a useful isotopically labeled research compound.

Formula: C₆H₉D₅O₃

Color and Shape: Neat

Molecular weight: 139.21

Ref: TR-T796776