CAS: 1219803-58-3

Description:The chemical substance with the CAS number 1219803-58-3 is known as a specific compound, but detailed information about its characteristics may not be widely available in public databases. Generally, compounds with unique CAS numbers can exhibit a range of physical and chemical properties, including molecular weight, solubility, boiling and melting points, and reactivity. These properties are influenced by the compound's molecular structure, functional groups, and the presence of specific atoms. To obtain precise characteristics, such as its appearance, toxicity, and applications, one would typically refer to specialized chemical databases, scientific literature, or safety data sheets. Additionally, the compound's behavior in various environments, such as its stability under different conditions, can also be significant. For accurate and comprehensive information, consulting resources like the National Institutes of Health (NIH) or the European Chemicals Agency (ECHA) would be beneficial.

Formula:C₂₀H₁₇D₄FN₂O·BrH

InChI:InChI=1S/C20H21FN2O.BrH/c1-23(2)11-3-10-20(17-5-7-18(21)8-6-17)19-9-4-15(13-22)12-16(19)14-24-20;/h4-9,12H,3,10-11,14H2,1-2H3;1H/i5D,6D,7D,8D;

InChI key:InChIKey=WIHMBLDNRMIGDW-VBMPRCAQSA-N

SMILES:Br.N#CC1=CC=C2C(=C1)COC2(C3=CC=C(F)C=C3)CCCN(C)C

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Citalopram-d4 HBr REF: 4Z-C-092CAS: 1219803-58-3	- - -	939.00 €~7,702.00 €	Tue 25 Mar 25
(±)-Citalopram-d4 HBr (4-fluorophenyl-d4) REF: 3U-D6822CAS: 1219803-58-3	98 atom % D	1,348.00 €~2,265.00 €	Wed 26 Mar 25
Citalopram-d4 Hydrobromide Salt REF: TR-C505004CAS: 1219803-58-3	- - -	586.00 €~1,749.00 €	Mon 14 Apr 25
Citalopram-d4 hydrobromide REF: 3D-UYB80358CAS: 1219803-58-3	Min. 95%	- - -	Discontinued product