CAS 1219803-89-0

3-Methyl-d3-4-nitrophenol--d3

Description:

3-Methyl-d3-4-nitrophenol-d3 is a deuterated derivative of 4-nitrophenol, where the methyl group is located at the meta position relative to the nitro group on the phenolic ring. The "d3" designation indicates that three hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen, which is often used in NMR spectroscopy and other analytical techniques to trace molecular pathways or improve resolution. This compound typically exhibits characteristics common to nitrophenols, such as being a weak acid due to the presence of the hydroxyl group, and it can participate in various chemical reactions, including electrophilic substitution. The nitro group is a strong electron-withdrawing group, which influences the reactivity and acidity of the compound. Additionally, the presence of deuterium can affect the physical properties, such as boiling and melting points, compared to its non-deuterated counterparts. Overall, 3-Methyl-d3-4-nitrophenol-d3 serves as a useful compound in research and analytical chemistry applications.

Formula: C₇HD₆NO₃

InChI: InChI=1S/C7H7NO3/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4,9H,1H3/i1D3,2D,3D,4D

InChI key: InChIKey=PIIZYNQECPTVEO-RLTMCGQMSA-N

SMILES: N(=O)(=O)C1=C(C([2H])([2H])[2H])C(=C(O)C(=C1[2H])[2H])[2H]

Synonyms:

• 3-Methyl-d3-4-nitrophenol--d3

3-Methyl-d3-4-nitrophenol-2,5,6-d3

CAS: 1219803-89-0

Purity: 98 atom % D

Color and Shape: Yellow Solid

Molecular weight: 159.17

Ref: 3U-D6242

3-Methyl-d3-4-nitrophenol-2,5,6-d3

Controlled Product

CAS: 1219803-89-0

Applications 3-Methyl-d3-4-nitrophenol-2,5,6-d3 (CAS# 1219803-89-0) is a useful isotopically labeled research compound.

Formula: C₇₂H₆HNO₃

Color and Shape: Beige To Brown

Molecular weight: 159.17

Ref: TR-N493756