CAS 1219804-69-9

4,6-Dinitro-2-Methyl-d3-phenol

Description:

4,6-Dinitro-2-Methyl-d3-phenol, with the CAS number 1219804-69-9, is a chemical compound characterized by the presence of two nitro groups and a methyl group attached to a phenolic structure. This compound is a deuterated derivative of 4,6-dinitro-2-methylphenol, where the hydrogen atoms in the methyl group are replaced with deuterium isotopes, enhancing its utility in various analytical applications, particularly in NMR spectroscopy. The nitro groups contribute to its electron-withdrawing properties, influencing its reactivity and solubility in organic solvents. Typically, compounds of this nature exhibit significant acidity due to the phenolic hydroxyl group, which can participate in hydrogen bonding and affect the compound's overall stability and reactivity. Additionally, the presence of nitro groups can impart explosive characteristics under certain conditions, necessitating careful handling and storage. Overall, 4,6-Dinitro-2-Methyl-d3-phenol serves as a valuable compound in research and industrial applications, particularly in the fields of organic synthesis and analytical chemistry.

Formula: C₇H₃D₃N₂O₅

InChI: InChI=1S/C7H6N2O5/c1-4-2-5(8(11)12)3-6(7(4)10)9(13)14/h2-3,10H,1H3/i1D3

InChI key: InChIKey=ZXVONLUNISGICL-FIBGUPNXSA-N

SMILES: N(=O)(=O)C1=CC(N(=O)=O)=CC(C([2H])([2H])[2H])=C1O

Synonyms:

• DNOC-d3
• 4,6-Dinitro-2-Methyl-d3-phenol

4,6-Dinitro-2-methyl-d3-phenol

CAS: 1219804-69-9

Formula: (NO₂)₂(CD₃)C₆H₂OH

Purity: 98 atom % D

Color and Shape: Yellow Solid

Molecular weight: 201.0465

Ref: 3U-D6987

4,6-Dinitro-2-methyl-d3-phenol

Controlled Product

CAS: 1219804-69-9

Applications 4,6-Dinitro-2-methyl-d3-phenol (CAS# 1219804-69-9) is a useful isotopically labeled research compound.

Formula: C₇H₃D₃N₂O₅

Color and Shape: Neat

Molecular weight: 201.15

Ref: TR-M221977