CAS 1219804-77-9

6-Fluorobenzen-2,4-d2-amine-d2

Description:

6-Fluorobenzen-2,4-d2-amine-d2 is a deuterated derivative of 6-fluoro-2,4-diaminobenzene, characterized by the presence of fluorine and deuterium isotopes. The compound features a benzene ring substituted with a fluorine atom at the 6-position and deuterium-labeled amine groups at the 2 and 4 positions. The incorporation of deuterium enhances its stability and alters its physical properties, making it useful in various applications, including tracer studies in pharmacokinetics and metabolic research. The presence of the fluorine atom can influence the compound's reactivity and interaction with biological systems, potentially affecting its pharmacological properties. As a chemical entity, it may exhibit characteristics typical of aromatic amines, such as basicity and the ability to participate in electrophilic substitution reactions. Its unique isotopic composition allows for advanced analytical techniques, such as NMR spectroscopy, to be employed for structural elucidation and quantification in complex mixtures. Overall, 6-Fluorobenzen-2,4-d2-amine-d2 serves as a valuable tool in both synthetic chemistry and biological research.

Formula: C₆H₂D₄FN

InChI: InChI=1S/C6H6FN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2/i1D,4D/hD2

InChI key: InChIKey=FTZQXOJYPFINKJ-PRAYLXBLSA-N

SMILES: FC1=C(N([2H])[2H])C(=CC(=C1)[2H])[2H]

Synonyms:

• 6-Fluorobenzen-2,4-d2-amine-d2
• Benzen-2,4-d2-amine-d2, 6-fluoro-

2-Fluoroaniline-4,6-d2,ND2

CAS: 1219804-77-9

Formula: FC₆H₂D₂ND₂

Purity: 98 atom % D

Color and Shape: Colorless To Brown Liquid

Molecular weight: 115.07353

Ref: 3U-D6903

2-Fluoroaniline-4,6-d2,ND2

Controlled Product

CAS: 1219804-77-9

Applications 2-Fluoroaniline-4,6-d2,ND2 (CAS# 1219804-77-9) is a useful isotopically labeled research compound.

Formula: C₆H₂D₄FN

Color and Shape: Neat

Molecular weight: 115.14

Ref: TR-F588284