CAS 1219805-72-7

3-Hydroxy-1,5-pentanedioic--d5 Acid

Description:

3-Hydroxy-1,5-pentanedioic acid, also known as a deuterated form of a dicarboxylic acid, is characterized by the presence of hydroxyl (-OH) and carboxylic acid (-COOH) functional groups within a five-carbon chain. The deuterated version, indicated by the "d5" in its name, suggests that five hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen. This substitution can influence the compound's physical and chemical properties, such as its solubility, reactivity, and NMR spectroscopic characteristics. The presence of both hydroxyl and carboxylic acid groups makes it a versatile compound, potentially useful in various applications, including biochemical research and synthesis. Its CAS number, 1219805-72-7, allows for precise identification in chemical databases. Overall, this compound's unique structure and isotopic labeling make it valuable for studies in metabolic pathways and tracer experiments in organic chemistry.

Formula: C₅H₈O₅

InChI: InChI=1S/C5H8O5/c6-3(1-4(7)8)2-5(9)10/h3,6H,1-2H2,(H,7,8)(H,9,10)/i1D2,2D2,3D

InChI key: InChIKey=ZQHYXNSQOIDNTL-UXXIZXEISA-N

SMILES: C(C(C(C(O)=O)([2H])[2H])(O)[2H])(C(O)=O)([2H])[2H]

Synonyms:

• 3-Hydroxy-1,5-pentanedioic--d5 Acid

3-Hydroxy-1,5-pentanedioic-2,2,3,4,4-d5 Acid

CAS: 1219805-72-7

Formula: HOOCCD₂CD(OH)CD₂COOH

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 153.06856

Ref: 3U-D6391

3-Hydroxyglutaric Acid-d5

Controlled Product

CAS: 1219805-72-7

Formula: C₅H₃D₅O₅

Color and Shape: Neat

Molecular weight: 153.14

Ref: TR-H942582