CAS 1219805-96-5

Cyclohexan-1,2,2,3,3,4,4,5,5,6,6-d11-amine

Description:

Cyclohexan-1,2,2,3,3,4,4,5,5,6,6-d11-amine, with the CAS number 1219805-96-5, is a deuterated derivative of cyclohexanamine. This compound features a cyclohexane ring with multiple deuterium atoms substituted at specific positions, which enhances its stability and alters its physical properties compared to its non-deuterated counterpart. The presence of the amine functional group indicates that it can participate in hydrogen bonding, making it potentially useful in various chemical reactions and applications, such as in pharmaceuticals or as a reagent in organic synthesis. The deuteration can also be advantageous in studies involving nuclear magnetic resonance (NMR) spectroscopy, as it provides clearer spectral data. Additionally, the compound's structural characteristics contribute to its unique reactivity and solubility profiles, which can be influenced by the arrangement of the deuterium atoms. Overall, Cyclohexan-1,2,2,3,3,4,4,5,5,6,6-d11-amine is a specialized compound with applications in research and industry, particularly in fields that require isotopically labeled materials.

Formula: C₆H₂D₁₁N

InChI: InChI=1S/C6H13N/c7-6-4-2-1-3-5-6/h6H,1-5,7H2/i1D2,2D2,3D2,4D2,5D2,6D

InChI key: InChIKey=PAFZNILMFXTMIY-KAFHOZLVSA-N

SMILES: NC1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H]

Synonyms:

• Cyclohexan-1,2,2,3,3,4,4,5,5,6,6-d11-amine

Cyclohexyl-d11-amine

CAS: 1219805-96-5

Formula: C₆D₁₁NH₂

Purity: 98 atom % D

Color and Shape: Colorless To Yellow Liquid

Molecular weight: 110.17384

Ref: 3U-D6305

Cyclohexanamine-D11

Controlled Product

CAS: 1219805-96-5

Applications Cyclohexanamine-D11 is a labelled analogue of Cyclohexylamine (C984555).
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the package

Formula: C₆₂H₁₁H₂N

Color and Shape: Neat

Molecular weight: 110.24

Ref: TR-C984557