CAS 1219806-05-9

2,3,5,6-Tetrachloroaniline-d3

Description:

2,3,5,6-Tetrachloroaniline-d3 is a deuterated derivative of tetrachloroaniline, characterized by the presence of four chlorine atoms attached to the aniline ring and three deuterium atoms replacing hydrogen atoms. This compound is typically used in research and analytical chemistry, particularly in studies involving environmental monitoring and toxicology, due to its stable isotopic labeling. The presence of chlorine atoms contributes to its hydrophobic nature and potential bioactivity, while the deuterium labeling allows for enhanced detection and quantification in mass spectrometry applications. As a chlorinated aromatic amine, it may exhibit properties such as moderate solubility in organic solvents and limited solubility in water. Safety considerations are important, as chlorinated compounds can pose environmental and health risks. Proper handling and disposal protocols should be followed to mitigate any potential hazards associated with this substance. Overall, 2,3,5,6-Tetrachloroaniline-d3 serves as a valuable tool in chemical research, particularly in the study of chlorinated compounds and their effects.

Formula: C₆Cl₄D₃N

InChI: InChI=1S/C6H3Cl4N/c7-2-1-3(8)5(10)6(11)4(2)9/h1H,11H2/i1D/hD2

InChI key: InChIKey=YTDHEFNWWHSXSU-AYQNKDEESA-N

SMILES: ClC1=C(N([2H])[2H])C(Cl)=C(Cl)C(=C1Cl)[2H]

Synonyms:

• 2,3,5,6-Tetrachloroaniline-d3

2,3,5,6-Tetrachloroaniline-d3

CAS: 1219806-05-9

Formula: Cl₄C₆DND₂

Purity: 99 atom % D

Color and Shape: White To Brown Solid

Molecular weight: 231.92079

Ref: 3U-D6911

2,3,5,6-Tetrachloroaniline-d3

Controlled Product

CAS: 1219806-05-9

Applications 2,3,5,6-Tetrachloroaniline-d3 (CAS# 1219806-05-9) is a useful isotopically labeled research compound.

Formula: C₆D₃Cl₄N

Color and Shape: Neat

Molecular weight: 233.92

Ref: TR-T291501