CAS 1219821-48-3
:9-(4-Biphenylyl)-3-(4-chlorophenyl)-9H-carbazole
Description:
9-(4-Biphenylyl)-3-(4-chlorophenyl)-9H-carbazole, identified by its CAS number 1219821-48-3, is an organic compound characterized by its complex structure, which includes a carbazole core substituted with biphenyl and chlorophenyl groups. This compound typically exhibits properties associated with organic semiconductors, making it of interest in the fields of organic electronics and photonics. Its molecular structure contributes to its potential applications in organic light-emitting diodes (OLEDs) and organic photovoltaic devices due to its ability to facilitate charge transport and light emission. The presence of the chlorophenyl group may influence its electronic properties, such as energy levels and stability, while the biphenyl moiety can enhance its solubility and processability. Additionally, the compound may exhibit fluorescence, which is a desirable trait for optoelectronic applications. Overall, the unique combination of functional groups in this compound positions it as a valuable material for research and development in advanced materials science.
Formula:C30H20ClN
InChI:InChI=1S/C30H20ClN/c31-25-15-10-23(11-16-25)24-14-19-30-28(20-24)27-8-4-5-9-29(27)32(30)26-17-12-22(13-18-26)21-6-2-1-3-7-21/h1-20H
Synonyms:- 9-Biphenyl-4-yl-3-(4-chloro-phenyl)-9H-carbazole
- 9-[1,1'-Biphenyl]-4-yl-3-(4-chlorophenyl)-9H-carbazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
9-([1,1'-Biphenyl]-4-yl)-3-(4-chlorophenyl)-9H-carbazole
CAS:Formula:C30H20ClNMolecular weight:429.9395
