CAS 1219827-76-5

Methyl 6-methoxy-1-(2-methoxyethyl)-1H-indole-2-carboxylate

Description:

Methyl 6-methoxy-1-(2-methoxyethyl)-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This specific compound features a methoxy group and a methoxyethyl substituent, contributing to its unique properties and potential biological activities. The presence of the carboxylate group indicates that it can participate in various chemical reactions, such as esterification or hydrolysis. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the indole moiety's known significance in drug design. The compound's solubility, stability, and reactivity can be influenced by the methoxy groups, which may enhance its lipophilicity and bioavailability. As with many indole derivatives, it may exhibit interesting pharmacological properties, making it a subject of interest for further research in the fields of organic chemistry and drug discovery.

Formula: C₁₄H₁₇NO₄

InChI: InChI=1S/C14H17NO4/c1-17-7-6-15-12-9-11(18-2)5-4-10(12)8-13(15)14(16)19-3/h4-5,8-9H,6-7H2,1-3H3

InChI key: InChIKey=HVJGDVHRAFWSFI-UHFFFAOYSA-N

SMILES: C(COC)N1C=2C(C=C1C(OC)=O)=CC=C(OC)C2

Synonyms:

• 1H-Indole-2-carboxylic acid, 6-methoxy-1-(2-methoxyethyl)-, methyl ester
• Methyl 6-methoxy-1-(2-methoxyethyl)-1H-indole-2-carboxylate