CAS 1219827-78-7

2-[(Cyclopropylcarbonyl)amino]-5,6-dihydro-4H-cyclopentathiazole-4-carboxylic acid

Description:

2-[(Cyclopropylcarbonyl)amino]-5,6-dihydro-4H-cyclopentathiazole-4-carboxylic acid is a chemical compound characterized by its unique structural features, which include a cyclopropyl group and a thiazole ring. This compound belongs to a class of heterocyclic compounds, which are known for their diverse biological activities. The presence of the cyclopropylcarbonyl group suggests potential reactivity and interaction with biological targets, making it of interest in medicinal chemistry. The carboxylic acid functional group contributes to its acidity and potential solubility in polar solvents. Additionally, the dihydro form of the cyclopentathiazole indicates that it may exhibit specific stereochemical properties that could influence its pharmacological profile. Overall, this compound's structural complexity and functional groups may provide avenues for further research into its applications in drug development or other chemical processes. However, detailed studies would be necessary to fully elucidate its properties, reactivity, and potential uses.

Formula: C₁₁H₁₂N₂O₃S

InChI: InChI=1S/C11H12N2O3S/c14-9(5-1-2-5)13-11-12-8-6(10(15)16)3-4-7(8)17-11/h5-6H,1-4H2,(H,15,16)(H,12,13,14)

InChI key: InChIKey=MYMJWPGYKCOHTM-UHFFFAOYSA-N

SMILES: C(O)(=O)C1C2=C(SC(NC(=O)C3CC3)=N2)CC1

Synonyms:

• 4H-Cyclopentathiazole-4-carboxylic acid, 2-[(cyclopropylcarbonyl)amino]-5,6-dihydro-
• 2-[(Cyclopropylcarbonyl)amino]-5,6-dihydro-4H-cyclopentathiazole-4-carboxylic acid